C21H23N — CID 102088618
2-methyl-1,5-bis(2-phenylethyl)pyrrole (PubChem CID 102088618) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-methyl-1,5-bis(2-phenylethyl)pyrrole.
| Compound Name | 2-methyl-1,5-bis(2-phenylethyl)pyrrole |
|---|---|
| PubChem CID | 102088618 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-methyl-1,5-bis(2-phenylethyl)pyrrole |
| SMILES | Cc1ccc(CCc2ccccc2)n1CCc1ccccc1 |
| InChI | InChI=1S/C21H23N/c1-18-12-14-21(15-13-19-8-4-2-5-9-19)22(18)17-16-20-10-6-3-7-11-20/h2-12,14H,13,15-17H2,1H3 |
| InChIKey | JLNOVOUFDJDHBQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |