C25H27F4NO2 — CID 160662347
2-ethyl-4-[2-[2-methyl-5-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]pyrrol-1-yl]ethyl]phenol (PubChem CID 160662347) has the molecular formula C25H27F4NO2 and a molecular weight of 449.49 g/mol. Its IUPAC name is 2-ethyl-4-[2-[2-methyl-5-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]pyrrol-1-yl]ethyl]phenol.
| Compound Name | 2-ethyl-4-[2-[2-methyl-5-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]pyrrol-1-yl]ethyl]phenol |
|---|---|
| PubChem CID | 160662347 |
| Molecular Formula | C25H27F4NO2 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-ethyl-4-[2-[2-methyl-5-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]pyrrol-1-yl]ethyl]phenol |
| SMILES | CCc1cc(CCn2c(C)ccc2CCc2cccc(OC(F)(F)C(F)F)c2)ccc1O |
| InChI | InChI=1S/C25H27F4NO2/c1-3-20-15-19(9-12-23(20)31)13-14-30-17(2)7-10-21(30)11-8-18-5-4-6-22(16-18)32-25(28,29)24(26)27/h4-7,9-10,12,15-16,24,31H,3,8,11,13-14H2,1-2H3 |
| InChIKey | RLVNSDPTKGOJQJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|