C15H15NS — CID 123346912
5-methyl-4-(2-phenylethyl)thieno[3,2-b]pyrrole (PubChem CID 123346912) has the molecular formula C15H15NS and a molecular weight of 241.36 g/mol. Its IUPAC name is 5-methyl-4-(2-phenylethyl)thieno[3,2-b]pyrrole.
| Compound Name | 5-methyl-4-(2-phenylethyl)thieno[3,2-b]pyrrole |
|---|---|
| PubChem CID | 123346912 |
| Molecular Formula | C15H15NS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 5-methyl-4-(2-phenylethyl)thieno[3,2-b]pyrrole |
| SMILES | Cc1cc2sccc2n1CCc1ccccc1 |
| InChI | InChI=1S/C15H15NS/c1-12-11-15-14(8-10-17-15)16(12)9-7-13-5-3-2-4-6-13/h2-6,8,10-11H,7,9H2,1H3 |
| InChIKey | XNYQKJGTRQPQSA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |