C22H20N2OS — CID 51889638
4-benzyl-N-[(1S)-1-phenylethyl]thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 51889638) has the molecular formula C22H20N2OS and a molecular weight of 360.48 g/mol. Its IUPAC name is 4-benzyl-N-[(1S)-1-phenylethyl]thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 4-benzyl-N-[(1S)-1-phenylethyl]thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 51889638 |
| Molecular Formula | C22H20N2OS |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 4-benzyl-N-[(1S)-1-phenylethyl]thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1cc2sccc2n1Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2OS/c1-16(18-10-6-3-7-11-18)23-22(25)20-14-21-19(12-13-26-21)24(20)15-17-8-4-2-5-9-17/h2-14,16H,15H2,1H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | KYXZFYSBBKPXKZ-INIZCTEOSA-N |
| XLogP | 5.24 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |