C22H19BrN2OS — CID 46040335
4-benzyl-3-bromo-N-(1-phenylethyl)thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 46040335) has the molecular formula C22H19BrN2OS and a molecular weight of 439.38 g/mol. Its IUPAC name is 4-benzyl-3-bromo-N-(1-phenylethyl)thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 4-benzyl-3-bromo-N-(1-phenylethyl)thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 46040335 |
| Molecular Formula | C22H19BrN2OS |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 4-benzyl-3-bromo-N-(1-phenylethyl)thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | CC(NC(=O)c1cc2scc(Br)c2n1Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19BrN2OS/c1-15(17-10-6-3-7-11-17)24-22(26)19-12-20-21(18(23)14-27-20)25(19)13-16-8-4-2-5-9-16/h2-12,14-15H,13H2,1H3,(H,24,26) |
| InChIKey | BOGFZDZWWCFRCW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |