C24H22N2O — CID 7313084
1-benzyl-N-[(1R)-1-phenylethyl]indole-2-carboxamide (PubChem CID 7313084) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-benzyl-N-[(1R)-1-phenylethyl]indole-2-carboxamide.
| Compound Name | 1-benzyl-N-[(1R)-1-phenylethyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 7313084 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-benzyl-N-[(1R)-1-phenylethyl]indole-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cc2ccccc2n1Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O/c1-18(20-12-6-3-7-13-20)25-24(27)23-16-21-14-8-9-15-22(21)26(23)17-19-10-4-2-5-11-19/h2-16,18H,17H2,1H3,(H,25,27)/t18-/m1/s1 |
| InChIKey | JOWSFZRBXSGBFR-GOSISDBHSA-N |
| XLogP | 5.18 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |