C11H9Cl2N — CID 12713084
1-benzyl-2,5-dichloropyrrole (PubChem CID 12713084) has the molecular formula C11H9Cl2N and a molecular weight of 226.11 g/mol. Its IUPAC name is 1-benzyl-2,5-dichloropyrrole.
| Compound Name | 1-benzyl-2,5-dichloropyrrole |
|---|---|
| PubChem CID | 12713084 |
| Molecular Formula | C11H9Cl2N |
| Molecular Weight | 226.11 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 1-benzyl-2,5-dichloropyrrole |
| SMILES | Clc1ccc(Cl)n1Cc1ccccc1 |
| InChI | InChI=1S/C11H9Cl2N/c12-10-6-7-11(13)14(10)8-9-4-2-1-3-5-9/h1-7H,8H2 |
| InChIKey | WFHNOHAFJPVFDX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.11 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |