C24H16N2O4 — CID 633879
2,6-dibenzylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 633879) has the molecular formula C24H16N2O4 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2,6-dibenzylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-dibenzylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 633879 |
| Molecular Formula | C24H16N2O4 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2,6-dibenzylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=c1c2cc3c(=O)n(Cc4ccccc4)c(=O)c3cc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H16N2O4/c27-21-17-11-19-20(24(30)26(23(19)29)14-16-9-5-2-6-10-16)12-18(17)22(28)25(21)13-15-7-3-1-4-8-15/h1-12H,13-14H2 |
| InChIKey | DIZGXQYAIZNBNJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |