C21H24INO3Si — CID 11225645
2-benzyl-4-iodo-6,7-dimethoxy-3-trimethylsilylisoquinolin-1-one (PubChem CID 11225645) has the molecular formula C21H24INO3Si and a molecular weight of 493.42 g/mol. Its IUPAC name is 2-benzyl-4-iodo-6,7-dimethoxy-3-trimethylsilylisoquinolin-1-one.
| Compound Name | 2-benzyl-4-iodo-6,7-dimethoxy-3-trimethylsilylisoquinolin-1-one |
|---|---|
| PubChem CID | 11225645 |
| Molecular Formula | C21H24INO3Si |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 2-benzyl-4-iodo-6,7-dimethoxy-3-trimethylsilylisoquinolin-1-one |
| SMILES | COc1cc2c(I)c([Si](C)(C)C)n(Cc3ccccc3)c(=O)c2cc1OC |
| InChI | InChI=1S/C21H24INO3Si/c1-25-17-11-15-16(12-18(17)26-2)20(24)23(13-14-9-7-6-8-10-14)21(19(15)22)27(3,4)5/h6-12H,13H2,1-5H3 |
| InChIKey | KDBBWLFSEMJUAZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|