C23H19ClN2O4 — CID 17172499
1-[(3-chlorophenyl)methyl]-6,7-dimethoxy-3-phenylquinazoline-2,4-dione (PubChem CID 17172499) has the molecular formula C23H19ClN2O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-6,7-dimethoxy-3-phenylquinazoline-2,4-dione.
| Compound Name | 1-[(3-chlorophenyl)methyl]-6,7-dimethoxy-3-phenylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 17172499 |
| Molecular Formula | C23H19ClN2O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-6,7-dimethoxy-3-phenylquinazoline-2,4-dione |
| SMILES | COc1cc2c(=O)n(-c3ccccc3)c(=O)n(Cc3cccc(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C23H19ClN2O4/c1-29-20-12-18-19(13-21(20)30-2)25(14-15-7-6-8-16(24)11-15)23(28)26(22(18)27)17-9-4-3-5-10-17/h3-13H,14H2,1-2H3 |
| InChIKey | XBOOCHKASSZGHE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |