C24H21ClN2O5 — CID 15989209
1-[(3-chlorophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)quinazoline-2,4-dione (PubChem CID 15989209) has the molecular formula C24H21ClN2O5 and a molecular weight of 452.89 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)quinazoline-2,4-dione.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 15989209 |
| Molecular Formula | C24H21ClN2O5 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)quinazoline-2,4-dione |
| SMILES | COc1cc(-n2c(=O)c3ccccc3n(Cc3cccc(Cl)c3)c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H21ClN2O5/c1-30-20-12-17(13-21(31-2)22(20)32-3)27-23(28)18-9-4-5-10-19(18)26(24(27)29)14-15-7-6-8-16(25)11-15/h4-13H,14H2,1-3H3 |
| InChIKey | SIAXOKUZWDYKDC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |