C23H19FN2O4 — CID 22423456
3-(2,4-dimethoxyphenyl)-1-[(3-fluorophenyl)methyl]quinazoline-2,4-dione (PubChem CID 22423456) has the molecular formula C23H19FN2O4 and a molecular weight of 406.41 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-[(3-fluorophenyl)methyl]quinazoline-2,4-dione.
| Compound Name | 3-(2,4-dimethoxyphenyl)-1-[(3-fluorophenyl)methyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 22423456 |
| Molecular Formula | C23H19FN2O4 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-[(3-fluorophenyl)methyl]quinazoline-2,4-dione |
| SMILES | COc1ccc(-n2c(=O)c3ccccc3n(Cc3cccc(F)c3)c2=O)c(OC)c1 |
| InChI | InChI=1S/C23H19FN2O4/c1-29-17-10-11-20(21(13-17)30-2)26-22(27)18-8-3-4-9-19(18)25(23(26)28)14-15-6-5-7-16(24)12-15/h3-13H,14H2,1-2H3 |
| InChIKey | XKVPLKJEXOJLBF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |