C22H17ClN2O2 — CID 17147921
3-(3-chlorophenyl)-1-[(4-methylphenyl)methyl]quinazoline-2,4-dione (PubChem CID 17147921) has the molecular formula C22H17ClN2O2 and a molecular weight of 376.84 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(4-methylphenyl)methyl]quinazoline-2,4-dione.
| Compound Name | 3-(3-chlorophenyl)-1-[(4-methylphenyl)methyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 17147921 |
| Molecular Formula | C22H17ClN2O2 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(4-methylphenyl)methyl]quinazoline-2,4-dione |
| SMILES | Cc1ccc(Cn2c(=O)n(-c3cccc(Cl)c3)c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H17ClN2O2/c1-15-9-11-16(12-10-15)14-24-20-8-3-2-7-19(20)21(26)25(22(24)27)18-6-4-5-17(23)13-18/h2-13H,14H2,1H3 |
| InChIKey | KCUSJITXAZDEPJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |