C24H20N2O4 — CID 95917068
methyl 2-[1-[(4-methylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]benzoate (PubChem CID 95917068) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is methyl 2-[1-[(4-methylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]benzoate.
| Compound Name | methyl 2-[1-[(4-methylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]benzoate |
|---|---|
| PubChem CID | 95917068 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | methyl 2-[1-[(4-methylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-n1c(=O)c2ccccc2n(Cc2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C24H20N2O4/c1-16-11-13-17(14-12-16)15-25-20-9-5-3-7-18(20)22(27)26(24(25)29)21-10-6-4-8-19(21)23(28)30-2/h3-14H,15H2,1-2H3 |
| InChIKey | DWEFBJXFNBWYOZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |