C29H31N3O4 — CID 53301901
N-(4-methoxybutyl)-4-[[1-[(4-methylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]methyl]benzamide (PubChem CID 53301901) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is N-(4-methoxybutyl)-4-[[1-[(4-methylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]methyl]benzamide.
| Compound Name | N-(4-methoxybutyl)-4-[[1-[(4-methylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 53301901 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-(4-methoxybutyl)-4-[[1-[(4-methylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]methyl]benzamide |
| SMILES | COCCCCNC(=O)c1ccc(Cn2c(=O)c3ccccc3n(Cc3ccc(C)cc3)c2=O)cc1 |
| InChI | InChI=1S/C29H31N3O4/c1-21-9-11-22(12-10-21)19-31-26-8-4-3-7-25(26)28(34)32(29(31)35)20-23-13-15-24(16-14-23)27(33)30-17-5-6-18-36-2/h3-4,7-16H,5-6,17-20H2,1-2H3,(H,30,33) |
| InChIKey | MJIRBCSANABODN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|