C28H28ClN3O6 — CID 50793489
4-[[1-[(3-chlorophenyl)methyl]-6,7-dimethoxy-2,4-dioxoquinazolin-3-yl]methyl]-N-(2-methoxyethyl)benzamide (PubChem CID 50793489) has the molecular formula C28H28ClN3O6 and a molecular weight of 538.00 g/mol. Its IUPAC name is 4-[[1-[(3-chlorophenyl)methyl]-6,7-dimethoxy-2,4-dioxoquinazolin-3-yl]methyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-[[1-[(3-chlorophenyl)methyl]-6,7-dimethoxy-2,4-dioxoquinazolin-3-yl]methyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 50793489 |
| Molecular Formula | C28H28ClN3O6 |
| Molecular Weight | 538.00 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 4-[[1-[(3-chlorophenyl)methyl]-6,7-dimethoxy-2,4-dioxoquinazolin-3-yl]methyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(Cn2c(=O)c3cc(OC)c(OC)cc3n(Cc3cccc(Cl)c3)c2=O)cc1 |
| InChI | InChI=1S/C28H28ClN3O6/c1-36-12-11-30-26(33)20-9-7-18(8-10-20)16-32-27(34)22-14-24(37-2)25(38-3)15-23(22)31(28(32)35)17-19-5-4-6-21(29)13-19/h4-10,13-15H,11-12,16-17H2,1-3H3,(H,30,33) |
| InChIKey | OZRUHUZEQUVLCN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.00 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|