C25H30N4O7 — CID 50793227
4-[[6,7-dimethoxy-1-[2-(3-methoxypropylamino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]methyl]-N-methylbenzamide (PubChem CID 50793227) has the molecular formula C25H30N4O7 and a molecular weight of 498.54 g/mol. Its IUPAC name is 4-[[6,7-dimethoxy-1-[2-(3-methoxypropylamino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]methyl]-N-methylbenzamide.
| Compound Name | 4-[[6,7-dimethoxy-1-[2-(3-methoxypropylamino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 50793227 |
| Molecular Formula | C25H30N4O7 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 4-[[6,7-dimethoxy-1-[2-(3-methoxypropylamino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(Cn2c(=O)c3cc(OC)c(OC)cc3n(CC(=O)NCCCOC)c2=O)cc1 |
| InChI | InChI=1S/C25H30N4O7/c1-26-23(31)17-8-6-16(7-9-17)14-29-24(32)18-12-20(35-3)21(36-4)13-19(18)28(25(29)33)15-22(30)27-10-5-11-34-2/h6-9,12-13H,5,10-11,14-15H2,1-4H3,(H,26,31)(H,27,30) |
| InChIKey | GBJQMIMJDJNLFQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|