C29H30FN3O5 — CID 50793341
N-butyl-4-[[1-[(3-fluorophenyl)methyl]-6,7-dimethoxy-2,4-dioxoquinazolin-3-yl]methyl]benzamide (PubChem CID 50793341) has the molecular formula C29H30FN3O5 and a molecular weight of 519.57 g/mol. Its IUPAC name is N-butyl-4-[[1-[(3-fluorophenyl)methyl]-6,7-dimethoxy-2,4-dioxoquinazolin-3-yl]methyl]benzamide.
| Compound Name | N-butyl-4-[[1-[(3-fluorophenyl)methyl]-6,7-dimethoxy-2,4-dioxoquinazolin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 50793341 |
| Molecular Formula | C29H30FN3O5 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | N-butyl-4-[[1-[(3-fluorophenyl)methyl]-6,7-dimethoxy-2,4-dioxoquinazolin-3-yl]methyl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(Cn2c(=O)c3cc(OC)c(OC)cc3n(Cc3cccc(F)c3)c2=O)cc1 |
| InChI | InChI=1S/C29H30FN3O5/c1-4-5-13-31-27(34)21-11-9-19(10-12-21)17-33-28(35)23-15-25(37-2)26(38-3)16-24(23)32(29(33)36)18-20-7-6-8-22(30)14-20/h6-12,14-16H,4-5,13,17-18H2,1-3H3,(H,31,34) |
| InChIKey | CVPZQRYXWLVISY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|