C25H19NO4 — CID 138585209
6-benzyl-8,9-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 138585209) has the molecular formula C25H19NO4 and a molecular weight of 397.43 g/mol. Its IUPAC name is 6-benzyl-8,9-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-benzyl-8,9-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 138585209 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 6-benzyl-8,9-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | COc1cc2c(cc1OC)-c1c(c3ccccc3c(=O)n1Cc1ccccc1)C2=O |
| InChI | InChI=1S/C25H19NO4/c1-29-20-12-18-19(13-21(20)30-2)24(27)22-16-10-6-7-11-17(16)25(28)26(23(18)22)14-15-8-4-3-5-9-15/h3-13H,14H2,1-2H3 |
| InChIKey | YZGUWQXJARDFRI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|