C24H17NO3 — CID 2826365
6-[(3-methoxyphenyl)methyl]indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 2826365) has the molecular formula C24H17NO3 and a molecular weight of 367.40 g/mol. Its IUPAC name is 6-[(3-methoxyphenyl)methyl]indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-[(3-methoxyphenyl)methyl]indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 2826365 |
| Molecular Formula | C24H17NO3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 6-[(3-methoxyphenyl)methyl]indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | COc1cccc(Cn2c3c(c4ccccc4c2=O)C(=O)c2ccccc2-3)c1 |
| InChI | InChI=1S/C24H17NO3/c1-28-16-8-6-7-15(13-16)14-25-22-18-10-3-4-11-19(18)23(26)21(22)17-9-2-5-12-20(17)24(25)27/h2-13H,14H2,1H3 |
| InChIKey | XWJDLROSRFJKAK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|