C26H19NO6 — CID 125429610
6-(1,3-benzodioxol-5-ylmethyl)-3,4-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 125429610) has the molecular formula C26H19NO6 and a molecular weight of 441.44 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethyl)-3,4-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-(1,3-benzodioxol-5-ylmethyl)-3,4-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 125429610 |
| Molecular Formula | C26H19NO6 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethyl)-3,4-dimethoxyindeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | COc1ccc2c3c(n(Cc4ccc5c(c4)OCO5)c(=O)c2c1OC)-c1ccccc1C3=O |
| InChI | InChI=1S/C26H19NO6/c1-30-19-10-8-17-21-23(15-5-3-4-6-16(15)24(21)28)27(26(29)22(17)25(19)31-2)12-14-7-9-18-20(11-14)33-13-32-18/h3-11H,12-13H2,1-2H3 |
| InChIKey | GDBRVPSHQYFQPM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|