C19H17NO6 — CID 53354868
2-[2-(1,3-benzodioxol-5-yl)ethyl]-4,5-dimethoxyisoindole-1,3-dione (PubChem CID 53354868) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)ethyl]-4,5-dimethoxyisoindole-1,3-dione.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)ethyl]-4,5-dimethoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 53354868 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)ethyl]-4,5-dimethoxyisoindole-1,3-dione |
| SMILES | COc1ccc2c(c1OC)C(=O)N(CCc1ccc3c(c1)OCO3)C2=O |
| InChI | InChI=1S/C19H17NO6/c1-23-14-6-4-12-16(17(14)24-2)19(22)20(18(12)21)8-7-11-3-5-13-15(9-11)26-10-25-13/h3-6,9H,7-8,10H2,1-2H3 |
| InChIKey | MBOSEOQZDKMYNU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|