C21H21NO5 — CID 5181338
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[(2-methoxyphenyl)methyl]pyrrolidine-2,5-dione (PubChem CID 5181338) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[(2-methoxyphenyl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[(2-methoxyphenyl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5181338 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[(2-methoxyphenyl)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccccc1CC1CC(=O)N(CCc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C21H21NO5/c1-25-17-5-3-2-4-15(17)11-16-12-20(23)22(21(16)24)9-8-14-6-7-18-19(10-14)27-13-26-18/h2-7,10,16H,8-9,11-13H2,1H3 |
| InChIKey | PLWBPYGDNFHSCW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|