C17H18O5S — CID 10711770
5-[(3,4-dimethoxyphenyl)methylsulfinylmethyl]-1,3-benzodioxole (PubChem CID 10711770) has the molecular formula C17H18O5S and a molecular weight of 334.39 g/mol. Its IUPAC name is 5-[(3,4-dimethoxyphenyl)methylsulfinylmethyl]-1,3-benzodioxole.
| Compound Name | 5-[(3,4-dimethoxyphenyl)methylsulfinylmethyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 10711770 |
| Molecular Formula | C17H18O5S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 5-[(3,4-dimethoxyphenyl)methylsulfinylmethyl]-1,3-benzodioxole |
| SMILES | COc1ccc(CS(=O)Cc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C17H18O5S/c1-19-14-5-3-12(7-16(14)20-2)9-23(18)10-13-4-6-15-17(8-13)22-11-21-15/h3-8H,9-11H2,1-2H3 |
| InChIKey | OPADIJDNFMOXQX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |