C16H16O5 — CID 71517955
6-[(3,4-dimethoxyphenyl)methyl]-1,3-benzodioxol-5-ol (PubChem CID 71517955) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 6-[(3,4-dimethoxyphenyl)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(3,4-dimethoxyphenyl)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 71517955 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 6-[(3,4-dimethoxyphenyl)methyl]-1,3-benzodioxol-5-ol |
| SMILES | COc1ccc(Cc2cc3c(cc2O)OCO3)cc1OC |
| InChI | InChI=1S/C16H16O5/c1-18-13-4-3-10(6-14(13)19-2)5-11-7-15-16(8-12(11)17)21-9-20-15/h3-4,6-8,17H,5,9H2,1-2H3 |
| InChIKey | PFTDPIYVUMTGHS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |