C19H24NO5+ — CID 9234050
(4,5-dimethoxy-2-methylphenyl)methyl-[(6-hydroxy-1,3-benzodioxol-5-yl)methyl]-methylazanium (PubChem CID 9234050) has the molecular formula C19H24NO5+ and a molecular weight of 346.40 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)methyl-[(6-hydroxy-1,3-benzodioxol-5-yl)methyl]-methylazanium.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)methyl-[(6-hydroxy-1,3-benzodioxol-5-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9234050 |
| Molecular Formula | C19H24NO5+ |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)methyl-[(6-hydroxy-1,3-benzodioxol-5-yl)methyl]-methylazanium |
| SMILES | COc1cc(C)c(C[NH+](C)Cc2cc3c(cc2O)OCO3)cc1OC |
| InChI | InChI=1S/C19H23NO5/c1-12-5-16(22-3)17(23-4)6-13(12)9-20(2)10-14-7-18-19(8-15(14)21)25-11-24-18/h5-8,21H,9-11H2,1-4H3/p+1 |
| InChIKey | HMPFNHFXWRQTIT-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 61.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|