C22H28N2O6 — CID 9324198
6-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol (PubChem CID 9324198) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 6-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 9324198 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 6-[[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol |
| SMILES | COc1ccc(CN2CCN(Cc3cc4c(cc3O)OCO4)CC2)c(OC)c1OC |
| InChI | InChI=1S/C22H28N2O6/c1-26-18-5-4-15(21(27-2)22(18)28-3)12-23-6-8-24(9-7-23)13-16-10-19-20(11-17(16)25)30-14-29-19/h4-5,10-11,25H,6-9,12-14H2,1-3H3 |
| InChIKey | WVZKHXVGPJTTJZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|