C20H24N2O4 — CID 4816117
6-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol (PubChem CID 4816117) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 6-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 4816117 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 6-[[4-(2-ethoxyphenyl)piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol |
| SMILES | CCOc1ccccc1N1CCN(Cc2cc3c(cc2O)OCO3)CC1 |
| InChI | InChI=1S/C20H24N2O4/c1-2-24-18-6-4-3-5-16(18)22-9-7-21(8-10-22)13-15-11-19-20(12-17(15)23)26-14-25-19/h3-6,11-12,23H,2,7-10,13-14H2,1H3 |
| InChIKey | WHTRGCOWEIDWJO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|