C16H24N2O3 — CID 115282428
6-[(4-tert-butylpiperazin-1-yl)methyl]-1,3-benzodioxol-5-ol (PubChem CID 115282428) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 6-[(4-tert-butylpiperazin-1-yl)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(4-tert-butylpiperazin-1-yl)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 115282428 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 6-[(4-tert-butylpiperazin-1-yl)methyl]-1,3-benzodioxol-5-ol |
| SMILES | CC(C)(C)N1CCN(Cc2cc3c(cc2O)OCO3)CC1 |
| InChI | InChI=1S/C16H24N2O3/c1-16(2,3)18-6-4-17(5-7-18)10-12-8-14-15(9-13(12)19)21-11-20-14/h8-9,19H,4-7,10-11H2,1-3H3 |
| InChIKey | PJPGEJCMNKMGQX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|