C21H23N3O3S — CID 46628690
6-[[4-[1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol (PubChem CID 46628690) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 6-[[4-[1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[[4-[1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 46628690 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 6-[[4-[1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]methyl]-1,3-benzodioxol-5-ol |
| SMILES | CC(c1nc2ccccc2s1)N1CCN(Cc2cc3c(cc2O)OCO3)CC1 |
| InChI | InChI=1S/C21H23N3O3S/c1-14(21-22-16-4-2-3-5-20(16)28-21)24-8-6-23(7-9-24)12-15-10-18-19(11-17(15)25)27-13-26-18/h2-5,10-11,14,25H,6-9,12-13H2,1H3 |
| InChIKey | FRTRZYUQMVNPOA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|