C23H23N3O2S2 — CID 43031251
2-[1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethyl]-1,3-benzothiazole (PubChem CID 43031251) has the molecular formula C23H23N3O2S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 2-[1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethyl]-1,3-benzothiazole.
| Compound Name | 2-[1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 43031251 |
| Molecular Formula | C23H23N3O2S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-[1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethyl]-1,3-benzothiazole |
| SMILES | CC(c1nc2ccccc2s1)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C23H23N3O2S2/c1-17(23-24-21-8-4-5-9-22(21)29-23)25-12-14-26(15-13-25)30(27,28)20-11-10-18-6-2-3-7-19(18)16-20/h2-11,16-17H,12-15H2,1H3 |
| InChIKey | KDXKEBMGRFTESD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |