C31H30N4O4S — CID 42722370
3-(2-methoxyphenyl)-2-[1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethyl]quinazolin-4-one (PubChem CID 42722370) has the molecular formula C31H30N4O4S and a molecular weight of 554.67 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-2-[1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethyl]quinazolin-4-one.
| Compound Name | 3-(2-methoxyphenyl)-2-[1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42722370 |
| Molecular Formula | C31H30N4O4S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 3-(2-methoxyphenyl)-2-[1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)ethyl]quinazolin-4-one |
| SMILES | COc1ccccc1-n1c(C(C)N2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C31H30N4O4S/c1-22(30-32-27-12-6-5-11-26(27)31(36)35(30)28-13-7-8-14-29(28)39-2)33-17-19-34(20-18-33)40(37,38)25-16-15-23-9-3-4-10-24(23)21-25/h3-16,21-22H,17-20H2,1-2H3 |
| InChIKey | SENMUXYGSQLKMH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |