C26H32N4O3 — CID 58710167
3-(2-methoxyphenyl)-2-[1-(4-pentanoylpiperazin-1-yl)ethyl]quinazolin-4-one (PubChem CID 58710167) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-2-[1-(4-pentanoylpiperazin-1-yl)ethyl]quinazolin-4-one.
| Compound Name | 3-(2-methoxyphenyl)-2-[1-(4-pentanoylpiperazin-1-yl)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 58710167 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 3-(2-methoxyphenyl)-2-[1-(4-pentanoylpiperazin-1-yl)ethyl]quinazolin-4-one |
| SMILES | CCCCC(=O)N1CCN(C(C)c2nc3ccccc3c(=O)n2-c2ccccc2OC)CC1 |
| InChI | InChI=1S/C26H32N4O3/c1-4-5-14-24(31)29-17-15-28(16-18-29)19(2)25-27-21-11-7-6-10-20(21)26(32)30(25)22-12-8-9-13-23(22)33-3/h6-13,19H,4-5,14-18H2,1-3H3 |
| InChIKey | HBVXNPPSZFBSAK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |