C26H31BrN4O2 — CID 42716002
3-(4-bromophenyl)-2-[1-(4-hexanoylpiperazin-1-yl)ethyl]quinazolin-4-one (PubChem CID 42716002) has the molecular formula C26H31BrN4O2 and a molecular weight of 511.46 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-[1-(4-hexanoylpiperazin-1-yl)ethyl]quinazolin-4-one.
| Compound Name | 3-(4-bromophenyl)-2-[1-(4-hexanoylpiperazin-1-yl)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42716002 |
| Molecular Formula | C26H31BrN4O2 |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 3-(4-bromophenyl)-2-[1-(4-hexanoylpiperazin-1-yl)ethyl]quinazolin-4-one |
| SMILES | CCCCCC(=O)N1CCN(C(C)c2nc3ccccc3c(=O)n2-c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C26H31BrN4O2/c1-3-4-5-10-24(32)30-17-15-29(16-18-30)19(2)25-28-23-9-7-6-8-22(23)26(33)31(25)21-13-11-20(27)12-14-21/h6-9,11-14,19H,3-5,10,15-18H2,1-2H3 |
| InChIKey | UYZIUPQQPJTSEA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|