C34H40N4O3 — CID 4286688
3-(2-methoxyphenyl)-2-[1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]ethyl]quinazolin-4-one (PubChem CID 4286688) has the molecular formula C34H40N4O3 and a molecular weight of 552.72 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-2-[1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]ethyl]quinazolin-4-one.
| Compound Name | 3-(2-methoxyphenyl)-2-[1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 4286688 |
| Molecular Formula | C34H40N4O3 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | 3-(2-methoxyphenyl)-2-[1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]ethyl]quinazolin-4-one |
| SMILES | CCCCCc1ccc(C(=O)N2CCN(C(C)c3nc4ccccc4c(=O)n3-c3ccccc3OC)CC2C)cc1 |
| InChI | InChI=1S/C34H40N4O3/c1-5-6-7-12-26-17-19-27(20-18-26)33(39)37-22-21-36(23-24(37)2)25(3)32-35-29-14-9-8-13-28(29)34(40)38(32)30-15-10-11-16-31(30)41-4/h8-11,13-20,24-25H,5-7,12,21-23H2,1-4H3 |
| InChIKey | WPNAOPXKJRAVHI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|