C24H26Cl2N4O3 — CID 11634556
2-[1-[4-(2,2-dichloroacetyl)-3-methylpiperazin-1-yl]ethyl]-3-(2-methoxyphenyl)quinazolin-4-one (PubChem CID 11634556) has the molecular formula C24H26Cl2N4O3 and a molecular weight of 489.40 g/mol. Its IUPAC name is 2-[1-[4-(2,2-dichloroacetyl)-3-methylpiperazin-1-yl]ethyl]-3-(2-methoxyphenyl)quinazolin-4-one.
| Compound Name | 2-[1-[4-(2,2-dichloroacetyl)-3-methylpiperazin-1-yl]ethyl]-3-(2-methoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 11634556 |
| Molecular Formula | C24H26Cl2N4O3 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-[1-[4-(2,2-dichloroacetyl)-3-methylpiperazin-1-yl]ethyl]-3-(2-methoxyphenyl)quinazolin-4-one |
| SMILES | COc1ccccc1-n1c(C(C)N2CCN(C(=O)C(Cl)Cl)C(C)C2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H26Cl2N4O3/c1-15-14-28(12-13-29(15)24(32)21(25)26)16(2)22-27-18-9-5-4-8-17(18)23(31)30(22)19-10-6-7-11-20(19)33-3/h4-11,15-16,21H,12-14H2,1-3H3 |
| InChIKey | AWJRHFZTZNEMKT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|