C30H32N4O3 — CID 11627395
3-(2-ethoxyphenyl)-2-[1-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]quinazolin-4-one (PubChem CID 11627395) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-2-[1-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]quinazolin-4-one.
| Compound Name | 3-(2-ethoxyphenyl)-2-[1-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 11627395 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 3-(2-ethoxyphenyl)-2-[1-[4-(2-methylbenzoyl)piperazin-1-yl]ethyl]quinazolin-4-one |
| SMILES | CCOc1ccccc1-n1c(C(C)N2CCN(C(=O)c3ccccc3C)CC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C30H32N4O3/c1-4-37-27-16-10-9-15-26(27)34-28(31-25-14-8-7-13-24(25)30(34)36)22(3)32-17-19-33(20-18-32)29(35)23-12-6-5-11-21(23)2/h5-16,22H,4,17-20H2,1-3H3 |
| InChIKey | KDUYCXMOJOJFNG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |