C28H25N3O4S — CID 42720888
N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylnaphthalene-2-sulfonamide (PubChem CID 42720888) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylnaphthalene-2-sulfonamide.
| Compound Name | N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 42720888 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylnaphthalene-2-sulfonamide |
| SMILES | COc1ccccc1-n1c(C(C)N(C)S(=O)(=O)c2ccc3ccccc3c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C28H25N3O4S/c1-19(30(2)36(33,34)22-17-16-20-10-4-5-11-21(20)18-22)27-29-24-13-7-6-12-23(24)28(32)31(27)25-14-8-9-15-26(25)35-3/h4-19H,1-3H3 |
| InChIKey | BWAJGDUXPYCIMM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |