C20H23N3O3S2 — CID 46823413
2-[1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-1,3-benzothiazole (PubChem CID 46823413) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-[1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-1,3-benzothiazole.
| Compound Name | 2-[1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 46823413 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-[1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-1,3-benzothiazole |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(C)c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-15(20-21-18-5-3-4-6-19(18)27-20)22-11-13-23(14-12-22)28(24,25)17-9-7-16(26-2)8-10-17/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | PKDWZYZDYWTCKC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |