C21H24F2N4O3S — CID 42926494
1-(difluoromethyl)-2-[1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]benzimidazole (PubChem CID 42926494) has the molecular formula C21H24F2N4O3S and a molecular weight of 450.51 g/mol. Its IUPAC name is 1-(difluoromethyl)-2-[1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]benzimidazole.
| Compound Name | 1-(difluoromethyl)-2-[1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]benzimidazole |
|---|---|
| PubChem CID | 42926494 |
| Molecular Formula | C21H24F2N4O3S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-(difluoromethyl)-2-[1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]benzimidazole |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(C)c3nc4ccccc4n3C(F)F)CC2)cc1 |
| InChI | InChI=1S/C21H24F2N4O3S/c1-15(20-24-18-5-3-4-6-19(18)27(20)21(22)23)25-11-13-26(14-12-25)31(28,29)17-9-7-16(30-2)8-10-17/h3-10,15,21H,11-14H2,1-2H3 |
| InChIKey | SLHFCAZKJCZFHK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |