C25H32F2N4O — CID 55499484
1-adamantyl-[4-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]piperazin-1-yl]methanone (PubChem CID 55499484) has the molecular formula C25H32F2N4O and a molecular weight of 442.55 g/mol. Its IUPAC name is 1-adamantyl-[4-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]piperazin-1-yl]methanone.
| Compound Name | 1-adamantyl-[4-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55499484 |
| Molecular Formula | C25H32F2N4O |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 1-adamantyl-[4-[1-[1-(difluoromethyl)benzimidazol-2-yl]ethyl]piperazin-1-yl]methanone |
| SMILES | CC(c1nc2ccccc2n1C(F)F)N1CCN(C(=O)C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C25H32F2N4O/c1-16(22-28-20-4-2-3-5-21(20)31(22)24(26)27)29-6-8-30(9-7-29)23(32)25-13-17-10-18(14-25)12-19(11-17)15-25/h2-5,16-19,24H,6-15H2,1H3 |
| InChIKey | UYAQOJAFLSWUSH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |