C22H25ClN4O4S — CID 59993378
5-chloro-2-[1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-3-methylquinazolin-4-one (PubChem CID 59993378) has the molecular formula C22H25ClN4O4S and a molecular weight of 476.99 g/mol. Its IUPAC name is 5-chloro-2-[1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-3-methylquinazolin-4-one.
| Compound Name | 5-chloro-2-[1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 59993378 |
| Molecular Formula | C22H25ClN4O4S |
| Molecular Weight | 476.99 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 5-chloro-2-[1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-3-methylquinazolin-4-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(C)c3nc4cccc(Cl)c4c(=O)n3C)CC2)cc1 |
| InChI | InChI=1S/C22H25ClN4O4S/c1-15(21-24-19-6-4-5-18(23)20(19)22(28)25(21)2)26-11-13-27(14-12-26)32(29,30)17-9-7-16(31-3)8-10-17/h4-10,15H,11-14H2,1-3H3 |
| InChIKey | FCSJVCSTINCNRR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.99 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |