C21H23BrN4O3S — CID 59993412
2-[1-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-6-bromo-3-methylquinazolin-4-one (PubChem CID 59993412) has the molecular formula C21H23BrN4O3S and a molecular weight of 491.41 g/mol. Its IUPAC name is 2-[1-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-6-bromo-3-methylquinazolin-4-one.
| Compound Name | 2-[1-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-6-bromo-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 59993412 |
| Molecular Formula | C21H23BrN4O3S |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 2-[1-[4-(benzenesulfonyl)piperazin-1-yl]ethyl]-6-bromo-3-methylquinazolin-4-one |
| SMILES | CC(c1nc2ccc(Br)cc2c(=O)n1C)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23BrN4O3S/c1-15(20-23-19-9-8-16(22)14-18(19)21(27)24(20)2)25-10-12-26(13-11-25)30(28,29)17-6-4-3-5-7-17/h3-9,14-15H,10-13H2,1-2H3 |
| InChIKey | KNQQHDCGJJRTIV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |