C19H20ClN3S — CID 173279216
2-[1-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazole (PubChem CID 173279216) has the molecular formula C19H20ClN3S and a molecular weight of 357.91 g/mol. Its IUPAC name is 2-[1-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazole.
| Compound Name | 2-[1-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 173279216 |
| Molecular Formula | C19H20ClN3S |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-[1-[4-(4-chlorophenyl)piperazin-1-yl]ethyl]-1,3-benzothiazole |
| SMILES | CC(c1nc2ccccc2s1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H20ClN3S/c1-14(19-21-17-4-2-3-5-18(17)24-19)22-10-12-23(13-11-22)16-8-6-15(20)7-9-16/h2-9,14H,10-13H2,1H3 |
| InChIKey | SBSDYYUXUSUHKU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |