C19H26N6S2 — CID 46697348
2-[[4-[1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]methyl]-4-propan-2-yl-1,2,4-triazole-3-thione (PubChem CID 46697348) has the molecular formula C19H26N6S2 and a molecular weight of 402.59 g/mol. Its IUPAC name is 2-[[4-[1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]methyl]-4-propan-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-[1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]methyl]-4-propan-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 46697348 |
| Molecular Formula | C19H26N6S2 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[[4-[1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]methyl]-4-propan-2-yl-1,2,4-triazole-3-thione |
| SMILES | CC(c1nc2ccccc2s1)N1CCN(Cn2ncn(C(C)C)c2=S)CC1 |
| InChI | InChI=1S/C19H26N6S2/c1-14(2)24-12-20-25(19(24)26)13-22-8-10-23(11-9-22)15(3)18-21-16-6-4-5-7-17(16)27-18/h4-7,12,14-15H,8-11,13H2,1-3H3 |
| InChIKey | MGGUWGCADNIKPH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|