C16H24N6S — CID 17459182
4-propan-2-yl-2-[[4-(pyridin-3-ylmethyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione (PubChem CID 17459182) has the molecular formula C16H24N6S and a molecular weight of 332.48 g/mol. Its IUPAC name is 4-propan-2-yl-2-[[4-(pyridin-3-ylmethyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-propan-2-yl-2-[[4-(pyridin-3-ylmethyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 17459182 |
| Molecular Formula | C16H24N6S |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 4-propan-2-yl-2-[[4-(pyridin-3-ylmethyl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione |
| SMILES | CC(C)n1cnn(CN2CCN(Cc3cccnc3)CC2)c1=S |
| InChI | InChI=1S/C16H24N6S/c1-14(2)21-12-18-22(16(21)23)13-20-8-6-19(7-9-20)11-15-4-3-5-17-10-15/h3-5,10,12,14H,6-9,11,13H2,1-2H3 |
| InChIKey | LNOGMHDPVVQDBW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|