C8H7BrO3 — CID 130132308
6-(bromomethyl)-1,3-benzodioxol-5-ol (PubChem CID 130132308) has the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. Its IUPAC name is 6-(bromomethyl)-1,3-benzodioxol-5-ol.
| Compound Name | 6-(bromomethyl)-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 130132308 |
| Molecular Formula | C8H7BrO3 |
| Molecular Weight | 231.04 g/mol |
| Exact Mass | 229.96 |
| IUPAC Name | 6-(bromomethyl)-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1CBr)OCO2 |
| InChI | InChI=1S/C8H7BrO3/c9-3-5-1-7-8(2-6(5)10)12-4-11-7/h1-2,10H,3-4H2 |
| InChIKey | LLQNSISQTQIMBK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.04 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|