C11H12O4 — CID 117297255
6-[(1-hydroxycyclopropyl)methyl]-1,3-benzodioxol-5-ol (PubChem CID 117297255) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is 6-[(1-hydroxycyclopropyl)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(1-hydroxycyclopropyl)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 117297255 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 6-[(1-hydroxycyclopropyl)methyl]-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1CC1(O)CC1)OCO2 |
| InChI | InChI=1S/C11H12O4/c12-8-4-10-9(14-6-15-10)3-7(8)5-11(13)1-2-11/h3-4,12-13H,1-2,5-6H2 |
| InChIKey | LERUPUKPWMRLKL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |