C7H5IO3 — CID 11173090
6-iodo-1,3-benzodioxol-5-ol (PubChem CID 11173090) has the molecular formula C7H5IO3 and a molecular weight of 264.02 g/mol. Its IUPAC name is 6-iodo-1,3-benzodioxol-5-ol.
| Compound Name | 6-iodo-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 11173090 |
| Molecular Formula | C7H5IO3 |
| Molecular Weight | 264.02 g/mol |
| Exact Mass | 263.93 |
| IUPAC Name | 6-iodo-1,3-benzodioxol-5-ol |
| SMILES | Oc1cc2c(cc1I)OCO2 |
| InChI | InChI=1S/C7H5IO3/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-2,9H,3H2 |
| InChIKey | ARSIMWCNXMDRRV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.02 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|