C24H16I2O4 — CID 101198729
5-iodo-6-[(Z)-2-[4-[(Z)-2-(6-iodo-1,3-benzodioxol-5-yl)ethenyl]phenyl]ethenyl]-1,3-benzodioxole (PubChem CID 101198729) has the molecular formula C24H16I2O4 and a molecular weight of 622.20 g/mol. Its IUPAC name is 5-iodo-6-[(Z)-2-[4-[(Z)-2-(6-iodo-1,3-benzodioxol-5-yl)ethenyl]phenyl]ethenyl]-1,3-benzodioxole.
| Compound Name | 5-iodo-6-[(Z)-2-[4-[(Z)-2-(6-iodo-1,3-benzodioxol-5-yl)ethenyl]phenyl]ethenyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 101198729 |
| Molecular Formula | C24H16I2O4 |
| Molecular Weight | 622.20 g/mol |
| Exact Mass | 621.91 |
| IUPAC Name | 5-iodo-6-[(Z)-2-[4-[(Z)-2-(6-iodo-1,3-benzodioxol-5-yl)ethenyl]phenyl]ethenyl]-1,3-benzodioxole |
| SMILES | Ic1cc2c(cc1/C=C\c1ccc(/C=C\c3cc4c(cc3I)OCO4)cc1)OCO2 |
| InChI | InChI=1S/C24H16I2O4/c25-19-11-23-21(27-13-29-23)9-17(19)7-5-15-1-2-16(4-3-15)6-8-18-10-22-24(12-20(18)26)30-14-28-22/h1-12H,13-14H2/b7-5-,8-6- |
| InChIKey | GXPVBASSLHZOCE-SFECMWDFSA-N |
| XLogP | 6.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.20 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|